C25H29NO5S — CID 156775716
4-methyl-N-[1-phenyl-3-(3,4,5-trimethoxyphenyl)propyl]benzenesulfonamide (PubChem CID 156775716) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-methyl-N-[1-phenyl-3-(3,4,5-trimethoxyphenyl)propyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-phenyl-3-(3,4,5-trimethoxyphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 156775716 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-methyl-N-[1-phenyl-3-(3,4,5-trimethoxyphenyl)propyl]benzenesulfonamide |
| SMILES | COc1cc(CCC(NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H29NO5S/c1-18-10-13-21(14-11-18)32(27,28)26-22(20-8-6-5-7-9-20)15-12-19-16-23(29-2)25(31-4)24(17-19)30-3/h5-11,13-14,16-17,22,26H,12,15H2,1-4H3 |
| InChIKey | MFPYAOZLDLFJGC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |