C16H17NO3S — CID 16743861
4-methyl-N-(3-oxo-1-phenylpropyl)benzenesulfonamide (PubChem CID 16743861) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-methyl-N-(3-oxo-1-phenylpropyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-oxo-1-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16743861 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-methyl-N-(3-oxo-1-phenylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO3S/c1-13-7-9-15(10-8-13)21(19,20)17-16(11-12-18)14-5-3-2-4-6-14/h2-10,12,16-17H,11H2,1H3 |
| InChIKey | QEPLHIIYDWWWJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|