C23H23NO2S — CID 11696524
N-[(Z,1R)-1,4-diphenylbut-3-enyl]-4-methylbenzenesulfonamide (PubChem CID 11696524) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[(Z,1R)-1,4-diphenylbut-3-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z,1R)-1,4-diphenylbut-3-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11696524 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[(Z,1R)-1,4-diphenylbut-3-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C/C=C\c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2S/c1-19-15-17-22(18-16-19)27(25,26)24-23(21-12-6-3-7-13-21)14-8-11-20-9-4-2-5-10-20/h2-13,15-18,23-24H,14H2,1H3/b11-8-/t23-/m1/s1 |
| InChIKey | LWKFJWHBOFAIEZ-JXOZOUPFSA-N |
| XLogP | 5.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |