C24H27NO2S2 — CID 152503716
4-methyl-N-(1-phenyl-4-phenylsulfanylpentyl)benzenesulfonamide (PubChem CID 152503716) has the molecular formula C24H27NO2S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 4-methyl-N-(1-phenyl-4-phenylsulfanylpentyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(1-phenyl-4-phenylsulfanylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 152503716 |
| Molecular Formula | C24H27NO2S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-methyl-N-(1-phenyl-4-phenylsulfanylpentyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCC(C)Sc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO2S2/c1-19-13-16-23(17-14-19)29(26,27)25-24(21-9-5-3-6-10-21)18-15-20(2)28-22-11-7-4-8-12-22/h3-14,16-17,20,24-25H,15,18H2,1-2H3 |
| InChIKey | YDZYNYAXKWEDPM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |