C24H29NO2S2Si — CID 102373680
4-methyl-N-[(1S,2R)-1-phenyl-2-phenylsulfanyl-2-trimethylsilylethyl]benzenesulfonamide (PubChem CID 102373680) has the molecular formula C24H29NO2S2Si and a molecular weight of 455.72 g/mol. Its IUPAC name is 4-methyl-N-[(1S,2R)-1-phenyl-2-phenylsulfanyl-2-trimethylsilylethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,2R)-1-phenyl-2-phenylsulfanyl-2-trimethylsilylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102373680 |
| Molecular Formula | C24H29NO2S2Si |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-methyl-N-[(1S,2R)-1-phenyl-2-phenylsulfanyl-2-trimethylsilylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)[C@@H](Sc2ccccc2)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C24H29NO2S2Si/c1-19-15-17-22(18-16-19)29(26,27)25-23(20-11-7-5-8-12-20)24(30(2,3)4)28-21-13-9-6-10-14-21/h5-18,23-25H,1-4H3/t23-,24-/m0/s1 |
| InChIKey | JVIHWZDIPKWEEQ-ZEQRLZLVSA-N |
| XLogP | 6.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|