C21H28BNO4S — CID 102133707
4-methyl-N-[1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzenesulfonamide (PubChem CID 102133707) has the molecular formula C21H28BNO4S and a molecular weight of 401.34 g/mol. Its IUPAC name is 4-methyl-N-[1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102133707 |
| Molecular Formula | C21H28BNO4S |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-methyl-N-[1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CB2OC(C)(C)C(C)(C)O2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28BNO4S/c1-16-11-13-18(14-12-16)28(24,25)23-19(17-9-7-6-8-10-17)15-22-26-20(2,3)21(4,5)27-22/h6-14,19,23H,15H2,1-5H3 |
| InChIKey | OGRXEZXYGKRNHH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|