C23H30BNO6S — CID 132522434
methyl 4-[1-[(4-methylphenyl)sulfonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzoate (PubChem CID 132522434) has the molecular formula C23H30BNO6S and a molecular weight of 459.37 g/mol. Its IUPAC name is methyl 4-[1-[(4-methylphenyl)sulfonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzoate.
| Compound Name | methyl 4-[1-[(4-methylphenyl)sulfonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 132522434 |
| Molecular Formula | C23H30BNO6S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 4-[1-[(4-methylphenyl)sulfonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(CB2OC(C)(C)C(C)(C)O2)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H30BNO6S/c1-16-7-13-19(14-8-16)32(27,28)25-20(15-24-30-22(2,3)23(4,5)31-24)17-9-11-18(12-10-17)21(26)29-6/h7-14,20,25H,15H2,1-6H3 |
| InChIKey | RNDGXBQFDUMFJZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|