C21H28BNO5S — CID 154713228
N-[(R)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 154713228) has the molecular formula C21H28BNO5S and a molecular weight of 417.34 g/mol. Its IUPAC name is N-[(R)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154713228 |
| Molecular Formula | C21H28BNO5S |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[(R)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc([C@H](NS(=O)(=O)c2ccc(C)cc2)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H28BNO5S/c1-15-7-13-18(14-8-15)29(24,25)23-19(16-9-11-17(26-6)12-10-16)22-27-20(2,3)21(4,5)28-22/h7-14,19,23H,1-6H3/t19-/m0/s1 |
| InChIKey | HVTWJCAXELXSPT-IBGZPJMESA-N |
| XLogP | 3.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|