C21H27BBrNO4S — CID 154718567
N-[1-(4-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 154718567) has the molecular formula C21H27BBrNO4S and a molecular weight of 480.23 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(4-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154718567 |
| Molecular Formula | C21H27BBrNO4S |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CB2OC(C)(C)C(C)(C)O2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H27BBrNO4S/c1-15-6-12-18(13-7-15)29(25,26)24-19(16-8-10-17(23)11-9-16)14-22-27-20(2,3)21(4,5)28-22/h6-13,19,24H,14H2,1-5H3 |
| InChIKey | RUOGZKHQXHXDKH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|