C21H23NO2S2 — CID 156775731
4-methyl-N-[1-(5-methylthiophen-2-yl)-3-phenylpropyl]benzenesulfonamide (PubChem CID 156775731) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-methyl-N-[1-(5-methylthiophen-2-yl)-3-phenylpropyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-(5-methylthiophen-2-yl)-3-phenylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 156775731 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-methyl-N-[1-(5-methylthiophen-2-yl)-3-phenylpropyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCc2ccccc2)c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C21H23NO2S2/c1-16-8-12-19(13-9-16)26(23,24)22-20(21-15-10-17(2)25-21)14-11-18-6-4-3-5-7-18/h3-10,12-13,15,20,22H,11,14H2,1-2H3 |
| InChIKey | GZQBUPKLHYUYGI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |