C23H33NO2S — CID 171485855
4-methyl-N-(3-methyl-1-phenylnonan-4-yl)benzenesulfonamide (PubChem CID 171485855) has the molecular formula C23H33NO2S and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1-phenylnonan-4-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-methyl-1-phenylnonan-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 171485855 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-methyl-N-(3-methyl-1-phenylnonan-4-yl)benzenesulfonamide |
| SMILES | CCCCCC(NS(=O)(=O)c1ccc(C)cc1)C(C)CCc1ccccc1 |
| InChI | InChI=1S/C23H33NO2S/c1-4-5-7-12-23(20(3)15-16-21-10-8-6-9-11-21)24-27(25,26)22-17-13-19(2)14-18-22/h6,8-11,13-14,17-18,20,23-24H,4-5,7,12,15-16H2,1-3H3 |
| InChIKey | BBBJVCMOVCFGOY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|