C22H27NO4S — CID 156772253
ethyl 2-ethylidene-3-[(4-methylphenyl)sulfonylamino]-5-phenylpentanoate (PubChem CID 156772253) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 2-ethylidene-3-[(4-methylphenyl)sulfonylamino]-5-phenylpentanoate.
| Compound Name | ethyl 2-ethylidene-3-[(4-methylphenyl)sulfonylamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 156772253 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 2-ethylidene-3-[(4-methylphenyl)sulfonylamino]-5-phenylpentanoate |
| SMILES | CC=C(C(=O)OCC)C(CCc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-4-20(22(24)27-5-2)21(16-13-18-9-7-6-8-10-18)23-28(25,26)19-14-11-17(3)12-15-19/h4,6-12,14-15,21,23H,5,13,16H2,1-3H3 |
| InChIKey | SLZKJKGCUKBECU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|