C23H33NO3S — CID 11361692
4-methyl-N-[(3R,4R)-3-(phenylmethoxymethyl)octan-4-yl]benzenesulfonamide (PubChem CID 11361692) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is 4-methyl-N-[(3R,4R)-3-(phenylmethoxymethyl)octan-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3R,4R)-3-(phenylmethoxymethyl)octan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11361692 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 4-methyl-N-[(3R,4R)-3-(phenylmethoxymethyl)octan-4-yl]benzenesulfonamide |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](CC)COCc1ccccc1 |
| InChI | InChI=1S/C23H33NO3S/c1-4-6-12-23(24-28(25,26)22-15-13-19(3)14-16-22)21(5-2)18-27-17-20-10-8-7-9-11-20/h7-11,13-16,21,23-24H,4-6,12,17-18H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | ITBMQUYEGNTDTJ-JTHBVZDNSA-N |
| XLogP | 5.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |