C36H41NO8S — CID 101391042
[(2S,3R,4R,5R)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-3,4,6-tris(phenylmethoxy)hexyl] acetate (PubChem CID 101391042) has the molecular formula C36H41NO8S and a molecular weight of 647.79 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-3,4,6-tris(phenylmethoxy)hexyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-3,4,6-tris(phenylmethoxy)hexyl] acetate |
|---|---|
| PubChem CID | 101391042 |
| Molecular Formula | C36H41NO8S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | [(2S,3R,4R,5R)-5-hydroxy-2-[(4-methylphenyl)sulfonylamino]-3,4,6-tris(phenylmethoxy)hexyl] acetate |
| SMILES | CC(=O)OC[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C36H41NO8S/c1-27-18-20-32(21-19-27)46(40,41)37-33(25-43-28(2)38)35(44-23-30-14-8-4-9-15-30)36(45-24-31-16-10-5-11-17-31)34(39)26-42-22-29-12-6-3-7-13-29/h3-21,33-37,39H,22-26H2,1-2H3/t33-,34+,35+,36+/m0/s1 |
| InChIKey | AYCJUVHRVBILGU-NJMTUYGZSA-N |
| XLogP | 4.95 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |