C18H26O5 — CID 10853279
[(2R,4S)-5-acetyloxy-2,4-dimethyl-3-phenylmethoxypentyl] acetate (PubChem CID 10853279) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(2R,4S)-5-acetyloxy-2,4-dimethyl-3-phenylmethoxypentyl] acetate.
| Compound Name | [(2R,4S)-5-acetyloxy-2,4-dimethyl-3-phenylmethoxypentyl] acetate |
|---|---|
| PubChem CID | 10853279 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | [(2R,4S)-5-acetyloxy-2,4-dimethyl-3-phenylmethoxypentyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)C(OCc1ccccc1)[C@@H](C)COC(C)=O |
| InChI | InChI=1S/C18H26O5/c1-13(10-21-15(3)19)18(14(2)11-22-16(4)20)23-12-17-8-6-5-7-9-17/h5-9,13-14,18H,10-12H2,1-4H3/t13-,14+,18? |
| InChIKey | ZCKVESMWKGDGPL-UUVAVEHKSA-N |
| XLogP | 2.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |