C23H31NO5 — CID 126481237
[(5R)-5-amino-2-methoxy-3,4-bis(phenylmethoxy)hexyl] acetate (PubChem CID 126481237) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [(5R)-5-amino-2-methoxy-3,4-bis(phenylmethoxy)hexyl] acetate.
| Compound Name | [(5R)-5-amino-2-methoxy-3,4-bis(phenylmethoxy)hexyl] acetate |
|---|---|
| PubChem CID | 126481237 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [(5R)-5-amino-2-methoxy-3,4-bis(phenylmethoxy)hexyl] acetate |
| SMILES | COC(COC(C)=O)C(OCc1ccccc1)C(OCc1ccccc1)[C@@H](C)N |
| InChI | InChI=1S/C23H31NO5/c1-17(24)22(28-14-19-10-6-4-7-11-19)23(21(26-3)16-27-18(2)25)29-15-20-12-8-5-9-13-20/h4-13,17,21-23H,14-16,24H2,1-3H3/t17-,21?,22?,23?/m1/s1 |
| InChIKey | HZVMKFIAPAZKHX-ZJEZHKNBSA-N |
| XLogP | 3.08 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |