C26H28O4 — CID 10024186
(3S,4S,5S)-5-hydroxy-1-phenyl-3,4-bis(phenylmethoxy)hexan-1-one (PubChem CID 10024186) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S,4S,5S)-5-hydroxy-1-phenyl-3,4-bis(phenylmethoxy)hexan-1-one.
| Compound Name | (3S,4S,5S)-5-hydroxy-1-phenyl-3,4-bis(phenylmethoxy)hexan-1-one |
|---|---|
| PubChem CID | 10024186 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3S,4S,5S)-5-hydroxy-1-phenyl-3,4-bis(phenylmethoxy)hexan-1-one |
| SMILES | C[C@H](O)[C@H](OCc1ccccc1)[C@H](CC(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H28O4/c1-20(27)26(30-19-22-13-7-3-8-14-22)25(29-18-21-11-5-2-6-12-21)17-24(28)23-15-9-4-10-16-23/h2-16,20,25-27H,17-19H2,1H3/t20-,25-,26-/m0/s1 |
| InChIKey | YTDXXSNUYMROOJ-XZZVZQAVSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |