C27H29FO5 — CID 90726684
(2R,3S,4S,5R)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanoyl fluoride (PubChem CID 90726684) has the molecular formula C27H29FO5 and a molecular weight of 452.52 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanoyl fluoride.
| Compound Name | (2R,3S,4S,5R)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanoyl fluoride |
|---|---|
| PubChem CID | 90726684 |
| Molecular Formula | C27H29FO5 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2R,3S,4S,5R)-5-hydroxy-2,3,4-tris(phenylmethoxy)hexanoyl fluoride |
| SMILES | C[C@@H](O)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)F |
| InChI | InChI=1S/C27H29FO5/c1-20(29)24(31-17-21-11-5-2-6-12-21)25(32-18-22-13-7-3-8-14-22)26(27(28)30)33-19-23-15-9-4-10-16-23/h2-16,20,24-26,29H,17-19H2,1H3/t20-,24+,25+,26-/m1/s1 |
| InChIKey | STIMKFSFEYIESP-IFKAHUTRSA-N |
| XLogP | 4.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|