C14H22O4 — CID 123316682
2-methyl-4-phenylmethoxyhexane-1,3,5-triol (PubChem CID 123316682) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methyl-4-phenylmethoxyhexane-1,3,5-triol.
| Compound Name | 2-methyl-4-phenylmethoxyhexane-1,3,5-triol |
|---|---|
| PubChem CID | 123316682 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-methyl-4-phenylmethoxyhexane-1,3,5-triol |
| SMILES | CC(O)C(OCc1ccccc1)C(O)C(C)CO |
| InChI | InChI=1S/C14H22O4/c1-10(8-15)13(17)14(11(2)16)18-9-12-6-4-3-5-7-12/h3-7,10-11,13-17H,8-9H2,1-2H3 |
| InChIKey | LVBTZUVWBVIDHH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |