C27H32O5 — CID 11048386
(2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)hexane-1,5-diol (PubChem CID 11048386) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)hexane-1,5-diol.
| Compound Name | (2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)hexane-1,5-diol |
|---|---|
| PubChem CID | 11048386 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)hexane-1,5-diol |
| SMILES | C[C@@H](O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C27H32O5/c1-21(29)26(31-19-23-13-7-3-8-14-23)27(32-20-24-15-9-4-10-16-24)25(17-28)30-18-22-11-5-2-6-12-22/h2-16,21,25-29H,17-20H2,1H3/t21-,25-,26+,27+/m1/s1 |
| InChIKey | BVFSCMMTVZNJBK-YICISRLPSA-N |
| XLogP | 4.12 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |