C36H42O6 — CID 158026470
(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(2-tritioethoxy)hexan-1-ol (PubChem CID 158026470) has the molecular formula C36H42O6 and a molecular weight of 572.73 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(2-tritioethoxy)hexan-1-ol.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(2-tritioethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 158026470 |
| Molecular Formula | C36H42O6 |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(2-tritioethoxy)hexan-1-ol |
| SMILES | [3H]CCOC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C36H42O6/c1-2-38-28-34(40-25-30-17-9-4-10-18-30)36(42-27-32-21-13-6-14-22-32)35(41-26-31-19-11-5-12-20-31)33(23-37)39-24-29-15-7-3-8-16-29/h3-22,33-37H,2,23-28H2,1H3/t33-,34-,35-,36-/m1/s1/i1T |
| InChIKey | SKXGLSOGPVGFPL-JHWVMYSTSA-N |
| XLogP | 6.36 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|