C41H44O6 — CID 122226978
(2R,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexan-1-ol (PubChem CID 122226978) has the molecular formula C41H44O6 and a molecular weight of 632.80 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexan-1-ol.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 122226978 |
| Molecular Formula | C41H44O6 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexan-1-ol |
| SMILES | OC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C41H44O6/c42-26-38(44-28-34-18-8-2-9-19-34)40(46-30-36-22-12-4-13-23-36)41(47-31-37-24-14-5-15-25-37)39(45-29-35-20-10-3-11-21-35)32-43-27-33-16-6-1-7-17-33/h1-25,38-42H,26-32H2/t38-,39-,40-,41-/m1/s1 |
| InChIKey | XPEAVZSVTDAMDK-GAKQXGIYSA-N |
| XLogP | 7.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |