C11H16O4 — CID 10921802
(2S,3S)-3-phenylmethoxybutane-1,2,4-triol (PubChem CID 10921802) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is (2S,3S)-3-phenylmethoxybutane-1,2,4-triol.
| Compound Name | (2S,3S)-3-phenylmethoxybutane-1,2,4-triol |
|---|---|
| PubChem CID | 10921802 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2S,3S)-3-phenylmethoxybutane-1,2,4-triol |
| SMILES | OC[C@H](OCc1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C11H16O4/c12-6-10(14)11(7-13)15-8-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | YYGZBCNOJHZTGA-QWRGUYRKSA-N |
| XLogP | -0.08 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |