C16H24O4 — CID 100933874
(E,2R,3S)-3-phenylmethoxynon-5-ene-1,2,9-triol (PubChem CID 100933874) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (E,2R,3S)-3-phenylmethoxynon-5-ene-1,2,9-triol.
| Compound Name | (E,2R,3S)-3-phenylmethoxynon-5-ene-1,2,9-triol |
|---|---|
| PubChem CID | 100933874 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (E,2R,3S)-3-phenylmethoxynon-5-ene-1,2,9-triol |
| SMILES | OCCC/C=C/C[C@H](OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C16H24O4/c17-11-7-2-1-6-10-16(15(19)12-18)20-13-14-8-4-3-5-9-14/h1,3-6,8-9,15-19H,2,7,10-13H2/b6-1+/t15-,16+/m1/s1 |
| InChIKey | GSFYDHIRPMTXCM-XZFCPUPVSA-N |
| XLogP | 1.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|