C19H30O2 — CID 134846538
(4R,5R)-4-ethyl-5-phenylmethoxydec-9-en-1-ol (PubChem CID 134846538) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (4R,5R)-4-ethyl-5-phenylmethoxydec-9-en-1-ol.
| Compound Name | (4R,5R)-4-ethyl-5-phenylmethoxydec-9-en-1-ol |
|---|---|
| PubChem CID | 134846538 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4R,5R)-4-ethyl-5-phenylmethoxydec-9-en-1-ol |
| SMILES | C=CCCC[C@@H](OCc1ccccc1)[C@H](CC)CCCO |
| InChI | InChI=1S/C19H30O2/c1-3-5-7-14-19(18(4-2)13-10-15-20)21-16-17-11-8-6-9-12-17/h3,6,8-9,11-12,18-20H,1,4-5,7,10,13-16H2,2H3/t18-,19-/m1/s1 |
| InChIKey | OBDDJDHEOLYUFW-RTBURBONSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|