About benzyl carbamate;pent-4-en-1-ol
benzyl carbamate;pent-4-en-1-ol (PubChem CID 155699875) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is benzyl carbamate;pent-4-en-1-ol.
Molecular Properties
| Compound Name | benzyl carbamate;pent-4-en-1-ol |
| PubChem CID | 155699875 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | benzyl carbamate;pent-4-en-1-ol |
| SMILES | C=CCCCO.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C5H10O/c9-8(10)11-6-7-4-2-1-3-5-7;1-2-3-4-5-6/h1-5H,6H2,(H2,9,10);2,6H,1,3-5H2 |
| InChIKey | KLRHXPRBGIDMQP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl carbamate;pent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl carbamate;pent-4-en-1-ol?
The IUPAC name of benzyl carbamate;pent-4-en-1-ol (CID 155699875) is benzyl carbamate;pent-4-en-1-ol.
What is the SMILES notation for benzyl carbamate;pent-4-en-1-ol?
The canonical SMILES for benzyl carbamate;pent-4-en-1-ol is C=CCCCO.NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl carbamate;pent-4-en-1-ol?
The InChIKey is KLRHXPRBGIDMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C5H10O/c9-8(10)11-6-7-4-2-1-3-5-7;1-2-3-4-5-6/h1-5H,6H2,(H2,9,10);2,6H,1,3-5H2.
What are the key properties of benzyl carbamate;pent-4-en-1-ol?
benzyl carbamate;pent-4-en-1-ol has a molecular weight of 237.30 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbamate;pent-4-en-1-ol is sourced from PubChem (CID 155699875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).