C11H16N2O5 — CID 67874309
(2S)-2-amino-3-hydroxypropanoic acid;benzyl carbamate (PubChem CID 67874309) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;benzyl carbamate.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;benzyl carbamate |
|---|---|
| PubChem CID | 67874309 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;benzyl carbamate |
| SMILES | NC(=O)OCc1ccccc1.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H9NO2.C3H7NO3/c9-8(10)11-6-7-4-2-1-3-5-7;4-2(1-5)3(6)7/h1-5H,6H2,(H2,9,10);2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | AXBLLYURCKLNNC-WNQIDUERSA-N |
| XLogP | -0.33 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |