About (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride
(2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride (PubChem CID 46735194) has the molecular formula C11H14ClNO4S
and a molecular weight of 291.76 g/mol. Its IUPAC name is (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride |
| PubChem CID | 46735194 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CSC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4S.ClH/c12-9(10(13)14)7-17-11(15)16-6-8-4-2-1-3-5-8;/h1-5,9H,6-7,12H2,(H,13,14);1H/t9-;/m0./s1 |
| InChIKey | BHHZAGMIVRJIIO-FVGYRXGTSA-N |
| XLogP | 1.89 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride?
The IUPAC name of (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride (CID 46735194) is (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride.
What is the SMILES notation for (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride?
The canonical SMILES for (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride is Cl.N[C@@H](CSC(=O)OCc1ccccc1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride?
The InChIKey is BHHZAGMIVRJIIO-FVGYRXGTSA-N. The full InChI is InChI=1S/C11H13NO4S.ClH/c12-9(10(13)14)7-17-11(15)16-6-8-4-2-1-3-5-8;/h1-5,9H,6-7,12H2,(H,13,14);1H/t9-;/m0./s1.
What are the key properties of (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride?
(2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride has a molecular weight of 291.76 g/mol, XLogP of 1.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid;hydrochloride is sourced from PubChem (CID 46735194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).