C12H13NO6S — CID 126705065
(2R)-2-amino-3-(benzoyloxymethoxycarbonylsulfanyl)propanoic acid (PubChem CID 126705065) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is (2R)-2-amino-3-(benzoyloxymethoxycarbonylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(benzoyloxymethoxycarbonylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 126705065 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (2R)-2-amino-3-(benzoyloxymethoxycarbonylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSC(=O)OCOC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H13NO6S/c13-9(10(14)15)6-20-12(17)19-7-18-11(16)8-4-2-1-3-5-8/h1-5,9H,6-7,13H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | PSJLGKJWWGMQHA-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|