C22H30N2O8S2 — CID 134483102
[(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-(2-morpholin-4-ylethoxy)-3-oxopropyl]sulfanylcarbonyloxymethyl benzoate (PubChem CID 134483102) has the molecular formula C22H30N2O8S2 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-(2-morpholin-4-ylethoxy)-3-oxopropyl]sulfanylcarbonyloxymethyl benzoate.
| Compound Name | [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-(2-morpholin-4-ylethoxy)-3-oxopropyl]sulfanylcarbonyloxymethyl benzoate |
|---|---|
| PubChem CID | 134483102 |
| Molecular Formula | C22H30N2O8S2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-(2-morpholin-4-ylethoxy)-3-oxopropyl]sulfanylcarbonyloxymethyl benzoate |
| SMILES | CC(C)(S)C(=O)N[C@@H](CSC(=O)OCOC(=O)c1ccccc1)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C22H30N2O8S2/c1-22(2,33)20(27)23-17(19(26)30-13-10-24-8-11-29-12-9-24)14-34-21(28)32-15-31-18(25)16-6-4-3-5-7-16/h3-7,17,33H,8-15H2,1-2H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | MBAIJFCHAVVCJM-KRWDZBQOSA-N |
| XLogP | 1.74 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|