C20H27NO7S2 — CID 134482987
[(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-oxo-3-phenylmethoxypropyl]sulfanylcarbonyloxymethyl 2-methylpropanoate (PubChem CID 134482987) has the molecular formula C20H27NO7S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-oxo-3-phenylmethoxypropyl]sulfanylcarbonyloxymethyl 2-methylpropanoate.
| Compound Name | [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-oxo-3-phenylmethoxypropyl]sulfanylcarbonyloxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 134482987 |
| Molecular Formula | C20H27NO7S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-oxo-3-phenylmethoxypropyl]sulfanylcarbonyloxymethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCOC(=O)SC[C@H](NC(=O)C(C)(C)S)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO7S2/c1-13(2)16(22)27-12-28-19(25)30-11-15(21-18(24)20(3,4)29)17(23)26-10-14-8-6-5-7-9-14/h5-9,13,15,29H,10-12H2,1-4H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | RLSLZLPIRPIALW-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|