C18H23NO7S2 — CID 134483056
benzyl (2R)-2-[[2-(acetyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoate (PubChem CID 134483056) has the molecular formula C18H23NO7S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is benzyl (2R)-2-[[2-(acetyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoate.
| Compound Name | benzyl (2R)-2-[[2-(acetyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 134483056 |
| Molecular Formula | C18H23NO7S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | benzyl (2R)-2-[[2-(acetyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoate |
| SMILES | CC(=O)OCOC(=O)SC(C)(C)C(=O)N[C@@H](CS)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO7S2/c1-12(20)25-11-26-17(23)28-18(2,3)16(22)19-14(10-27)15(21)24-9-13-7-5-4-6-8-13/h4-8,14,27H,9-11H2,1-3H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | LZDOUQUJMNRIHS-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|