C30H29NO10S — CID 142436314
[(2S)-3-(benzoyloxymethoxycarbonylsulfanyl)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyloxymethyl benzoate (PubChem CID 142436314) has the molecular formula C30H29NO10S and a molecular weight of 595.63 g/mol. Its IUPAC name is [(2S)-3-(benzoyloxymethoxycarbonylsulfanyl)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyloxymethyl benzoate.
| Compound Name | [(2S)-3-(benzoyloxymethoxycarbonylsulfanyl)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyloxymethyl benzoate |
|---|---|
| PubChem CID | 142436314 |
| Molecular Formula | C30H29NO10S |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | [(2S)-3-(benzoyloxymethoxycarbonylsulfanyl)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyloxymethyl benzoate |
| SMILES | CC(C)(SC(=O)OCOC(=O)c1ccccc1)[C@@H](NC(=O)OCOC(=O)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H29NO10S/c1-30(2,42-29(36)41-20-39-26(33)23-16-10-5-11-17-23)24(27(34)37-18-21-12-6-3-7-13-21)31-28(35)40-19-38-25(32)22-14-8-4-9-15-22/h3-17,24H,18-20H2,1-2H3,(H,31,35)/t24-/m0/s1 |
| InChIKey | KMTPOVCVJVJMOC-DEOSSOPVSA-N |
| XLogP | 5.10 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|