C19H29NO4 — CID 10497026
benzyl (2S)-3,3-dimethyl-2-(pentan-3-yloxycarbonylamino)butanoate (PubChem CID 10497026) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is benzyl (2S)-3,3-dimethyl-2-(pentan-3-yloxycarbonylamino)butanoate.
| Compound Name | benzyl (2S)-3,3-dimethyl-2-(pentan-3-yloxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10497026 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | benzyl (2S)-3,3-dimethyl-2-(pentan-3-yloxycarbonylamino)butanoate |
| SMILES | CCC(CC)OC(=O)N[C@H](C(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H29NO4/c1-6-15(7-2)24-18(22)20-16(19(3,4)5)17(21)23-13-14-11-9-8-10-12-14/h8-12,15-16H,6-7,13H2,1-5H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | SIGDJVCOFZLYTG-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |