C22H29N3O2 — CID 89192593
benzyl N-[(3S)-2-(2-benzylhydrazinyl)-4,4-dimethylpent-1-en-3-yl]carbamate (PubChem CID 89192593) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is benzyl N-[(3S)-2-(2-benzylhydrazinyl)-4,4-dimethylpent-1-en-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-2-(2-benzylhydrazinyl)-4,4-dimethylpent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 89192593 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | benzyl N-[(3S)-2-(2-benzylhydrazinyl)-4,4-dimethylpent-1-en-3-yl]carbamate |
| SMILES | C=C(NNCc1ccccc1)[C@@H](NC(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H29N3O2/c1-17(25-23-15-18-11-7-5-8-12-18)20(22(2,3)4)24-21(26)27-16-19-13-9-6-10-14-19/h5-14,20,23,25H,1,15-16H2,2-4H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | ONYZDFUUDOTHLJ-HXUWFJFHSA-N |
| XLogP | 4.14 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|