C16H21NO6 — CID 70070486
(2S,3S)-2-tert-butyl-3-(phenylmethoxycarbonylamino)butanedioic acid (PubChem CID 70070486) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S,3S)-2-tert-butyl-3-(phenylmethoxycarbonylamino)butanedioic acid.
| Compound Name | (2S,3S)-2-tert-butyl-3-(phenylmethoxycarbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 70070486 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2S,3S)-2-tert-butyl-3-(phenylmethoxycarbonylamino)butanedioic acid |
| SMILES | CC(C)(C)[C@H](C(=O)O)[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H21NO6/c1-16(2,3)11(13(18)19)12(14(20)21)17-15(22)23-9-10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3,(H,17,22)(H,18,19)(H,20,21)/t11-,12-/m0/s1 |
| InChIKey | INILVVRYUSAMIQ-RYUDHWBXSA-N |
| XLogP | 2.11 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |