C13H14Cl3NO4S — CID 11280643
2,2,2-trichloroethyl (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate (PubChem CID 11280643) has the molecular formula C13H14Cl3NO4S and a molecular weight of 386.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate.
| Compound Name | 2,2,2-trichloroethyl (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 11280643 |
| Molecular Formula | C13H14Cl3NO4S |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate |
| SMILES | O=C(N[C@H](CS)C(=O)OCC(Cl)(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C13H14Cl3NO4S/c14-13(15,16)8-21-11(18)10(7-22)17-12(19)20-6-9-4-2-1-3-5-9/h1-5,10,22H,6-8H2,(H,17,19)/t10-/m1/s1 |
| InChIKey | HZUWDLJGALVUKN-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|