C17H22Cl3NO5 — CID 141223739
2,2,2-trichloroethyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 141223739) has the molecular formula C17H22Cl3NO5 and a molecular weight of 426.72 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | 2,2,2-trichloroethyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 141223739 |
| Molecular Formula | C17H22Cl3NO5 |
| Molecular Weight | 426.72 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H22Cl3NO5/c1-16(2,3)26-10-13(14(22)25-11-17(18,19)20)21-15(23)24-9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | BTLSJTRJDFPDBV-ZDUSSCGKSA-N |
| XLogP | 4.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|