C22H27NO6 — CID 146471668
3-(2-methyl-2-phenylmethoxypropoxy)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 146471668) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-(2-methyl-2-phenylmethoxypropoxy)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2-methyl-2-phenylmethoxypropoxy)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 146471668 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-(2-methyl-2-phenylmethoxypropoxy)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(C)(COCC(NC(=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO6/c1-22(2,29-14-18-11-7-4-8-12-18)16-27-15-19(20(24)25)23-21(26)28-13-17-9-5-3-6-10-17/h3-12,19H,13-16H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | PPMIKSNYMKKGOV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |