C16H18Cl3NO6 — CID 162413768
5-O-benzyl 1-O-methyl (2R)-2-(2,2,2-trichloroethoxycarbonylamino)pentanedioate (PubChem CID 162413768) has the molecular formula C16H18Cl3NO6 and a molecular weight of 426.68 g/mol. Its IUPAC name is 5-O-benzyl 1-O-methyl (2R)-2-(2,2,2-trichloroethoxycarbonylamino)pentanedioate.
| Compound Name | 5-O-benzyl 1-O-methyl (2R)-2-(2,2,2-trichloroethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 162413768 |
| Molecular Formula | C16H18Cl3NO6 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 5-O-benzyl 1-O-methyl (2R)-2-(2,2,2-trichloroethoxycarbonylamino)pentanedioate |
| SMILES | COC(=O)[C@@H](CCC(=O)OCc1ccccc1)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3NO6/c1-24-14(22)12(20-15(23)26-10-16(17,18)19)7-8-13(21)25-9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | UAHPCCHDJTWWHN-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|