C32H35BF4NO3P — CID 57336997
[(1S)-2-[(2-methylpropan-2-yl)oxy]-1-(phenylmethoxycarbonylamino)ethyl]-triphenylphosphanium tetrafluoroborate (PubChem CID 57336997) has the molecular formula C32H35BF4NO3P and a molecular weight of 599.41 g/mol. Its IUPAC name is [(1S)-2-[(2-methylpropan-2-yl)oxy]-1-(phenylmethoxycarbonylamino)ethyl]-triphenylphosphanium tetrafluoroborate.
| Compound Name | [(1S)-2-[(2-methylpropan-2-yl)oxy]-1-(phenylmethoxycarbonylamino)ethyl]-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 57336997 |
| Molecular Formula | C32H35BF4NO3P |
| Molecular Weight | 599.41 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | [(1S)-2-[(2-methylpropan-2-yl)oxy]-1-(phenylmethoxycarbonylamino)ethyl]-triphenylphosphanium tetrafluoroborate |
| SMILES | CC(C)(C)OC[C@@H](NC(=O)OCc1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C32H34NO3P.BF4/c1-32(2,3)36-25-30(33-31(34)35-24-26-16-8-4-9-17-26)37(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29;2-1(3,4)5/h4-23,30H,24-25H2,1-3H3;/q;-1/p+1/t30-;/m0./s1 |
| InChIKey | XEEXLQJVESAPCD-CZCBIWLKSA-O |
| XLogP | 7.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.41 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|