C16H25NO5 — CID 143574648
benzyl N-[1-[(2-methylpropan-2-yl)oxy]propan-2-yl]carbamate;formic acid (PubChem CID 143574648) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is benzyl N-[1-[(2-methylpropan-2-yl)oxy]propan-2-yl]carbamate;formic acid.
| Compound Name | benzyl N-[1-[(2-methylpropan-2-yl)oxy]propan-2-yl]carbamate;formic acid |
|---|---|
| PubChem CID | 143574648 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | benzyl N-[1-[(2-methylpropan-2-yl)oxy]propan-2-yl]carbamate;formic acid |
| SMILES | CC(COC(C)(C)C)NC(=O)OCc1ccccc1.O=CO |
| InChI | InChI=1S/C15H23NO3.CH2O2/c1-12(10-19-15(2,3)4)16-14(17)18-11-13-8-6-5-7-9-13;2-1-3/h5-9,12H,10-11H2,1-4H3,(H,16,17);1H,(H,2,3) |
| InChIKey | FJCHKUSSTDDMSK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|