C16H32N2O2 — CID 160578481
benzyl N-[(2S)-butan-2-yl]carbamate;(2S)-butan-2-amine;deuterium monohydride (PubChem CID 160578481) has the molecular formula C16H32N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is benzyl N-[(2S)-butan-2-yl]carbamate;(2S)-butan-2-amine;deuterium monohydride.
| Compound Name | benzyl N-[(2S)-butan-2-yl]carbamate;(2S)-butan-2-amine;deuterium monohydride |
|---|---|
| PubChem CID | 160578481 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | benzyl N-[(2S)-butan-2-yl]carbamate;(2S)-butan-2-amine;deuterium monohydride |
| SMILES | CC[C@H](C)N.CC[C@H](C)NC(=O)OCc1ccccc1.[H][2H].[H][2H] |
| InChI | InChI=1S/C12H17NO2.C4H11N.2H2/c1-3-10(2)13-12(14)15-9-11-7-5-4-6-8-11;1-3-4(2)5;;/h4-8,10H,3,9H2,1-2H3,(H,13,14);4H,3,5H2,1-2H3;2*1H/t10-;4-;;/m00../s1/i;;2*1+1 |
| InChIKey | RBLQRFFNKIJTKF-OAVJLOFJSA-N |
| XLogP | 3.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |