C33H35NO4P+ — CID 57337382
[(1S)-3-[(2-methylpropan-2-yl)oxy]-3-oxo-1-(phenylmethoxycarbonylamino)propyl]-triphenylphosphanium (PubChem CID 57337382) has the molecular formula C33H35NO4P+ and a molecular weight of 540.62 g/mol. Its IUPAC name is [(1S)-3-[(2-methylpropan-2-yl)oxy]-3-oxo-1-(phenylmethoxycarbonylamino)propyl]-triphenylphosphanium.
| Compound Name | [(1S)-3-[(2-methylpropan-2-yl)oxy]-3-oxo-1-(phenylmethoxycarbonylamino)propyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 57337382 |
| Molecular Formula | C33H35NO4P+ |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(1S)-3-[(2-methylpropan-2-yl)oxy]-3-oxo-1-(phenylmethoxycarbonylamino)propyl]-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)C[C@@H](NC(=O)OCc1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34NO4P/c1-33(2,3)38-31(35)24-30(34-32(36)37-25-26-16-8-4-9-17-26)39(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-23,30H,24-25H2,1-3H3/p+1/t30-/m0/s1 |
| InChIKey | KEUDMHLHCJALRN-PMERELPUSA-O |
| XLogP | 5.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|