C16H21ClN2O5 — CID 90977014
tert-butyl (3S)-4-chloro-4-nitroso-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 90977014) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is tert-butyl (3S)-4-chloro-4-nitroso-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (3S)-4-chloro-4-nitroso-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 90977014 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | tert-butyl (3S)-4-chloro-4-nitroso-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)OCc1ccccc1)C(Cl)N=O |
| InChI | InChI=1S/C16H21ClN2O5/c1-16(2,3)24-13(20)9-12(14(17)19-22)18-15(21)23-10-11-7-5-4-6-8-11/h4-8,12,14H,9-10H2,1-3H3,(H,18,21)/t12-,14?/m0/s1 |
| InChIKey | ZHIHASABDXBFKY-NBFOIZRFSA-N |
| XLogP | 3.34 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|