C18H20N2O3S — CID 54125429
benzyl N-[(2R)-1-(benzylamino)-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 54125429) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(benzylamino)-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(benzylamino)-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54125429 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | benzyl N-[(2R)-1-(benzylamino)-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CS)C(=O)NCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S/c21-17(19-11-14-7-3-1-4-8-14)16(13-24)20-18(22)23-12-15-9-5-2-6-10-15/h1-10,16,24H,11-13H2,(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | NQQDCDDUVGAJJA-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|