C14H21NO2S — CID 141266319
benzyl (2R)-2-(tert-butylamino)-3-sulfanylpropanoate (PubChem CID 141266319) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is benzyl (2R)-2-(tert-butylamino)-3-sulfanylpropanoate.
| Compound Name | benzyl (2R)-2-(tert-butylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 141266319 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | benzyl (2R)-2-(tert-butylamino)-3-sulfanylpropanoate |
| SMILES | CC(C)(C)N[C@@H](CS)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H21NO2S/c1-14(2,3)15-12(10-18)13(16)17-9-11-7-5-4-6-8-11/h4-8,12,15,18H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | CQACHIBXEYUFSM-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|