C23H30N2O3S — CID 70144592
benzyl (2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-tert-butylsulfanylpropanoate (PubChem CID 70144592) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-tert-butylsulfanylpropanoate.
| Compound Name | benzyl (2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-tert-butylsulfanylpropanoate |
|---|---|
| PubChem CID | 70144592 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | benzyl (2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-tert-butylsulfanylpropanoate |
| SMILES | CC(C)(C)SC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-23(2,3)29-16-20(22(27)28-15-18-12-8-5-9-13-18)25-21(26)19(24)14-17-10-6-4-7-11-17/h4-13,19-20H,14-16,24H2,1-3H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | QQIJYCUZCWNGNS-PMACEKPBSA-N |
| XLogP | 3.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |