C32H40N4O4 — CID 176769001
(4-methylphenyl)methyl (2S)-2,6-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate (PubChem CID 176769001) has the molecular formula C32H40N4O4 and a molecular weight of 544.70 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-2,6-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate.
| Compound Name | (4-methylphenyl)methyl (2S)-2,6-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 176769001 |
| Molecular Formula | C32H40N4O4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-2,6-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate |
| SMILES | Cc1ccc(COC(=O)[C@H](CCCCNC(=O)[C@@H](N)Cc2ccccc2)NC(=O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H40N4O4/c1-23-15-17-26(18-16-23)22-40-32(39)29(36-31(38)28(34)21-25-12-6-3-7-13-25)14-8-9-19-35-30(37)27(33)20-24-10-4-2-5-11-24/h2-7,10-13,15-18,27-29H,8-9,14,19-22,33-34H2,1H3,(H,35,37)(H,36,38)/t27-,28-,29-/m0/s1 |
| InChIKey | DCCVDEYJPJBXSZ-AWCRTANDSA-N |
| XLogP | 2.95 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|