C19H32N4O3 — CID 57051472
benzyl 6-amino-2-(2,6-diaminohexanoylamino)hexanoate (PubChem CID 57051472) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is benzyl 6-amino-2-(2,6-diaminohexanoylamino)hexanoate.
| Compound Name | benzyl 6-amino-2-(2,6-diaminohexanoylamino)hexanoate |
|---|---|
| PubChem CID | 57051472 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | benzyl 6-amino-2-(2,6-diaminohexanoylamino)hexanoate |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H32N4O3/c20-12-6-4-10-16(22)18(24)23-17(11-5-7-13-21)19(25)26-14-15-8-2-1-3-9-15/h1-3,8-9,16-17H,4-7,10-14,20-22H2,(H,23,24) |
| InChIKey | DMGBGRRPSAKHGV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|